| 1. | Panthenol's expanded chemical formula is HO–CH2–C(CH3)2–CH(OH)–CONH–CH2CH2CH2–OH. Le panthénol a comme formule semi-développée HO–CH2–C(CH3)2–CH(OH)–CONH–CH2CH2CH2–OH. |
| 2. | The generic chemical formula is C10H8−(m+n)Cl(m+n). La formule brute générique est C10H8−(m+n)Cl(m+m). |
| 3. | It has the chemical formula of (Ce,Na,Ca)(Ti,Nb)O3. Sa formule chimique est (Ce,Na,Ca)(Ti,Nb)O3. |
| 4. | Its chemical formula is Cu4SO4(OH)6. Sa formule chimique est Cu4SO4 (OH) 6. |
| 5. | NaCl is the chemical formula for sodium chloride. NaClO est la formule chimique de l'hypochlorite de sodium. |
| 6. | It is an ester with the chemical formula C6H5CO2CH3. Il s'agit d'un ester de formule chimique C6H5CO2CH3. |
| 7. | Trigonelline is an alkaloid with chemical formula C7H7NO2. La trigonelline est un alcaloïde de formule chimique C7H7NO2. |
| 8. | Its corresponding chemical formula is ZrSiO4. Sa formule chimique est LiAlSiO4. |
| 9. | Its chemical formula is (Mg,Fe)SiO3. Sa formule chimique est (Mg,Fe)SiO3. |
| 10. | Its chemical formula is CH3(CH2)11(OCH2CH2)nOSO3Na. Sa formule chimique est CH3(CH2)11(OCH2CH2)nOSO3Na avec n = 3-4. |